About 3-amino-4-methyl-2,5-dipropylbenzamide
3-amino-4-methyl-2,5-dipropylbenzamide (PubChem CID 87531245) has the molecular formula C14H22N2O
and a molecular weight of 234.34 g/mol. Its IUPAC name is 3-amino-4-methyl-2,5-dipropylbenzamide.
Molecular Properties
| Compound Name | 3-amino-4-methyl-2,5-dipropylbenzamide |
| PubChem CID | 87531245 |
| Molecular Formula | C14H22N2O |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.17 |
| IUPAC Name | 3-amino-4-methyl-2,5-dipropylbenzamide |
| SMILES | CCCc1cc(C(N)=O)c(CCC)c(N)c1C |
| InChI | InChI=1S/C14H22N2O/c1-4-6-10-8-12(14(16)17)11(7-5-2)13(15)9(10)3/h8H,4-7,15H2,1-3H3,(H2,16,17) |
| InChIKey | NFRMMQLBLSNIEC-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-4-methyl-2,5-dipropylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-4-methyl-2,5-dipropylbenzamide?
The IUPAC name of 3-amino-4-methyl-2,5-dipropylbenzamide (CID 87531245) is 3-amino-4-methyl-2,5-dipropylbenzamide.
What is the SMILES notation for 3-amino-4-methyl-2,5-dipropylbenzamide?
The canonical SMILES for 3-amino-4-methyl-2,5-dipropylbenzamide is CCCc1cc(C(N)=O)c(CCC)c(N)c1C.
What is the InChIKey of 3-amino-4-methyl-2,5-dipropylbenzamide?
The InChIKey is NFRMMQLBLSNIEC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O/c1-4-6-10-8-12(14(16)17)11(7-5-2)13(15)9(10)3/h8H,4-7,15H2,1-3H3,(H2,16,17).
What are the key properties of 3-amino-4-methyl-2,5-dipropylbenzamide?
3-amino-4-methyl-2,5-dipropylbenzamide has a molecular weight of 234.34 g/mol, XLogP of 2.58, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-4-methyl-2,5-dipropylbenzamide is sourced from PubChem (CID 87531245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).