About [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate
[(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate (PubChem CID 87531348) has the molecular formula C12H14N2O5S
and a molecular weight of 298.32 g/mol. Its IUPAC name is [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate.
Molecular Properties
| Compound Name | [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate |
| PubChem CID | 87531348 |
| Molecular Formula | C12H14N2O5S |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate |
| SMILES | CC(C)C[C@@H](C#N)OS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C12H14N2O5S/c1-9(2)7-11(8-13)19-20(17,18)12-5-3-10(4-6-12)14(15)16/h3-6,9,11H,7H2,1-2H3/t11-/m0/s1 |
| InChIKey | OMLGELOAJMUAAM-NSHDSACASA-N |
| XLogP | 2.24 |
| TPSA | 110.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate?
The IUPAC name of [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate (CID 87531348) is [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate.
What is the SMILES notation for [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate?
The canonical SMILES for [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate is CC(C)C[C@@H](C#N)OS(=O)(=O)c1ccc([N+](=O)[O-])cc1.
What is the InChIKey of [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate?
The InChIKey is OMLGELOAJMUAAM-NSHDSACASA-N. The full InChI is InChI=1S/C12H14N2O5S/c1-9(2)7-11(8-13)19-20(17,18)12-5-3-10(4-6-12)14(15)16/h3-6,9,11H,7H2,1-2H3/t11-/m0/s1.
What are the key properties of [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate?
[(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate has a molecular weight of 298.32 g/mol, XLogP of 2.24, 6 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-1-cyano-3-methylbutyl] 4-nitrobenzenesulfonate is sourced from PubChem (CID 87531348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).