C15H19N3O4S2 — CID 87531460
methyl 3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate (PubChem CID 87531460) has the molecular formula C15H19N3O4S2 and a molecular weight of 369.47 g/mol. Its IUPAC name is methyl 3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate.
| Compound Name | methyl 3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate |
|---|---|
| PubChem CID | 87531460 |
| Molecular Formula | C15H19N3O4S2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.08 |
| IUPAC Name | methyl 3-[[5-[(5-tert-butyl-1,3-oxazol-2-yl)methylsulfanyl]-1,3-thiazol-2-yl]amino]-3-oxopropanoate |
| SMILES | COC(=O)CC(=O)Nc1ncc(SCc2ncc(C(C)(C)C)o2)s1 |
| InChI | InChI=1S/C15H19N3O4S2/c1-15(2,3)9-6-16-11(22-9)8-23-13-7-17-14(24-13)18-10(19)5-12(20)21-4/h6-7H,5,8H2,1-4H3,(H,17,18,19) |
| InChIKey | XRKBWRJEEDHDLJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 94.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|