C15H33N3O2 — CID 87532205
tert-butyl N,N-bis[1-(dimethylamino)propyl]carbamate (PubChem CID 87532205) has the molecular formula C15H33N3O2 and a molecular weight of 287.45 g/mol. Its IUPAC name is tert-butyl N,N-bis[1-(dimethylamino)propyl]carbamate.
| Compound Name | tert-butyl N,N-bis[1-(dimethylamino)propyl]carbamate |
|---|---|
| PubChem CID | 87532205 |
| Molecular Formula | C15H33N3O2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | tert-butyl N,N-bis[1-(dimethylamino)propyl]carbamate |
| SMILES | CCC(N(C)C)N(C(=O)OC(C)(C)C)C(CC)N(C)C |
| InChI | InChI=1S/C15H33N3O2/c1-10-12(16(6)7)18(13(11-2)17(8)9)14(19)20-15(3,4)5/h12-13H,10-11H2,1-9H3 |
| InChIKey | OFJIKWKADJPNPE-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|