C22H10F22N2O4 — CID 87532325
4-[4-amino-2-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]phenyl]-3-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]aniline (PubChem CID 87532325) has the molecular formula C22H10F22N2O4 and a molecular weight of 784.29 g/mol. Its IUPAC name is 4-[4-amino-2-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]phenyl]-3-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]aniline.
| Compound Name | 4-[4-amino-2-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]phenyl]-3-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]aniline |
|---|---|
| PubChem CID | 87532325 |
| Molecular Formula | C22H10F22N2O4 |
| Molecular Weight | 784.29 g/mol |
| Exact Mass | 784.03 |
| IUPAC Name | 4-[4-amino-2-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]phenyl]-3-[1,1,2,2-tetrafluoro-2-(1,1,1,2,3,3,3-heptafluoropropan-2-yloxy)ethoxy]aniline |
| SMILES | Nc1ccc(-c2ccc(N)cc2OC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)c(OC(F)(F)C(F)(F)OC(F)(C(F)(F)F)C(F)(F)F)c1 |
| InChI | InChI=1S/C22H10F22N2O4/c23-13(15(25,26)27,16(28,29)30)49-21(41,42)19(37,38)47-11-5-7(45)1-3-9(11)10-4-2-8(46)6-12(10)48-20(39,40)22(43,44)50-14(24,17(31,32)33)18(34,35)36/h1-6H,45-46H2 |
| InChIKey | KHLNHSGOPLOYHK-UHFFFAOYSA-N |
| XLogP | 9.26 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 784.29 |
| LogP ≤ 5 | 9.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|