About CID 87532527
CID 87532527 (PubChem CID 87532527) has the molecular formula C6H14BClP
and a molecular weight of 163.42 g/mol.
Molecular Properties
| Compound Name | CID 87532527 |
| PubChem CID | 87532527 |
| Molecular Formula | C6H14BClP |
| Molecular Weight | 163.42 g/mol |
| Exact Mass | 163.06 |
| IUPAC Name | — |
| SMILES | CC(C)P(Cl)C(C)C.[B] |
| InChI | InChI=1S/C6H14ClP.B/c1-5(2)8(7)6(3)4;/h5-6H,1-4H3; |
| InChIKey | MIHAJUJPDATNCL-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 87532527 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87532527?
The IUPAC name of CID 87532527 (CID 87532527) is not available.
What is the SMILES notation for CID 87532527?
The canonical SMILES for CID 87532527 is CC(C)P(Cl)C(C)C.[B].
What is the InChIKey of CID 87532527?
The InChIKey is MIHAJUJPDATNCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14ClP.B/c1-5(2)8(7)6(3)4;/h5-6H,1-4H3;.
What are the key properties of CID 87532527?
CID 87532527 has a molecular weight of 163.42 g/mol, XLogP of 3.06, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87532527 is sourced from PubChem (CID 87532527), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).