About butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate
butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate (PubChem CID 87532605) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| PubChem CID | 87532605 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC1CO1.CCCCOC(=O)C1=CCC1 |
| InChI | InChI=1S/C9H14O2.C7H10O3/c1-2-3-7-11-9(10)8-5-4-6-8;1-5(2)7(8)10-4-6-3-9-6/h5H,2-4,6-7H2,1H3;6H,1,3-4H2,2H3 |
| InChIKey | FPDHYRCCPCYIID-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The IUPAC name of butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate (CID 87532605) is butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate.
What is the SMILES notation for butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The canonical SMILES for butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate is C=C(C)C(=O)OCC1CO1.CCCCOC(=O)C1=CCC1.
What is the InChIKey of butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
The InChIKey is FPDHYRCCPCYIID-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O2.C7H10O3/c1-2-3-7-11-9(10)8-5-4-6-8;1-5(2)7(8)10-4-6-3-9-6/h5H,2-4,6-7H2,1H3;6H,1,3-4H2,2H3.
What are the key properties of butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate?
butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate has a molecular weight of 296.36 g/mol, XLogP of 2.55, 7 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for butyl cyclobutene-1-carboxylate;oxiran-2-ylmethyl 2-methylprop-2-enoate is sourced from PubChem (CID 87532605), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).