C20H32N4O4 — CID 87532642
N,N-bis(2-hydroxyethyl)-2-[4-[[4-(2-hydroxyethylamino)cyclohexa-1,4-dien-1-yl]amino]anilino]ethanamine oxide (PubChem CID 87532642) has the molecular formula C20H32N4O4 and a molecular weight of 392.50 g/mol. Its IUPAC name is N,N-bis(2-hydroxyethyl)-2-[4-[[4-(2-hydroxyethylamino)cyclohexa-1,4-dien-1-yl]amino]anilino]ethanamine oxide.
| Compound Name | N,N-bis(2-hydroxyethyl)-2-[4-[[4-(2-hydroxyethylamino)cyclohexa-1,4-dien-1-yl]amino]anilino]ethanamine oxide |
|---|---|
| PubChem CID | 87532642 |
| Molecular Formula | C20H32N4O4 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | N,N-bis(2-hydroxyethyl)-2-[4-[[4-(2-hydroxyethylamino)cyclohexa-1,4-dien-1-yl]amino]anilino]ethanamine oxide |
| SMILES | [O-][N+](CCO)(CCO)CCNc1ccc(NC2=CCC(NCCO)=CC2)cc1 |
| InChI | InChI=1S/C20H32N4O4/c25-14-10-22-18-3-7-20(8-4-18)23-19-5-1-17(2-6-19)21-9-11-24(28,12-15-26)13-16-27/h1-3,5-6,8,21-23,25-27H,4,7,9-16H2 |
| InChIKey | AFLBBQJRNQIOLJ-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 119.84 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|