About buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol
buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol (PubChem CID 87532739) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol.
Molecular Properties
| Compound Name | buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol |
| PubChem CID | 87532739 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol |
| SMILES | C=CC=C.OCC1CCC(CO)CC1 |
| InChI | InChI=1S/C8H16O2.C4H6/c9-5-7-1-2-8(6-10)4-3-7;1-3-4-2/h7-10H,1-6H2;3-4H,1-2H2 |
| InChIKey | SVDNGUMZJJVNBS-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol?
The IUPAC name of buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol (CID 87532739) is buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol.
What is the SMILES notation for buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol?
The canonical SMILES for buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol is C=CC=C.OCC1CCC(CO)CC1.
What is the InChIKey of buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol?
The InChIKey is SVDNGUMZJJVNBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C4H6/c9-5-7-1-2-8(6-10)4-3-7;1-3-4-2/h7-10H,1-6H2;3-4H,1-2H2.
What are the key properties of buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol?
buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol has a molecular weight of 198.31 g/mol, XLogP of 2.14, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for buta-1,3-diene;[4-(hydroxymethyl)cyclohexyl]methanol is sourced from PubChem (CID 87532739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).