C30H30F4N4O6S — CID 87533201
4-[2-(8-benzyl-2,4-dioxo-1,3-diaza-8-azoniaspiro[4.5]decan-1-yl)-4-fluorophenyl]-N,N-dimethylbenzenesulfonamide;2,2,2-trifluoroacetate (PubChem CID 87533201) has the molecular formula C30H30F4N4O6S and a molecular weight of 650.65 g/mol. Its IUPAC name is 4-[2-(8-benzyl-2,4-dioxo-1,3-diaza-8-azoniaspiro[4.5]decan-1-yl)-4-fluorophenyl]-N,N-dimethylbenzenesulfonamide;2,2,2-trifluoroacetate.
| Compound Name | 4-[2-(8-benzyl-2,4-dioxo-1,3-diaza-8-azoniaspiro[4.5]decan-1-yl)-4-fluorophenyl]-N,N-dimethylbenzenesulfonamide;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87533201 |
| Molecular Formula | C30H30F4N4O6S |
| Molecular Weight | 650.65 g/mol |
| Exact Mass | 650.18 |
| IUPAC Name | 4-[2-(8-benzyl-2,4-dioxo-1,3-diaza-8-azoniaspiro[4.5]decan-1-yl)-4-fluorophenyl]-N,N-dimethylbenzenesulfonamide;2,2,2-trifluoroacetate |
| SMILES | CN(C)S(=O)(=O)c1ccc(-c2ccc(F)cc2N2C(=O)NC(=O)C23CC[NH+](Cc2ccccc2)CC3)cc1.O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C28H29FN4O4S.C2HF3O2/c1-31(2)38(36,37)23-11-8-21(9-12-23)24-13-10-22(29)18-25(24)33-27(35)30-26(34)28(33)14-16-32(17-15-28)19-20-6-4-3-5-7-20;3-2(4,5)1(6)7/h3-13,18H,14-17,19H2,1-2H3,(H,30,34,35);(H,6,7) |
| InChIKey | KCLRXRRQDUQJRC-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 131.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|