About 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine
5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine (PubChem CID 87533400) has the molecular formula C13H16Cl2N2O2S
and a molecular weight of 335.26 g/mol. Its IUPAC name is 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine.
Molecular Properties
| Compound Name | 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine |
| PubChem CID | 87533400 |
| Molecular Formula | C13H16Cl2N2O2S |
| Molecular Weight | 335.26 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine |
| SMILES | Nc1nc2cc(OCCCCl)c(OCCCCl)cc2s1 |
| InChI | InChI=1S/C13H16Cl2N2O2S/c14-3-1-5-18-10-7-9-12(20-13(16)17-9)8-11(10)19-6-2-4-15/h7-8H,1-6H2,(H2,16,17) |
| InChIKey | PSVIDUTYXQBGLU-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 57.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.26 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine?
The IUPAC name of 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine (CID 87533400) is 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine.
What is the SMILES notation for 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine?
The canonical SMILES for 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine is Nc1nc2cc(OCCCCl)c(OCCCCl)cc2s1.
What is the InChIKey of 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine?
The InChIKey is PSVIDUTYXQBGLU-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16Cl2N2O2S/c14-3-1-5-18-10-7-9-12(20-13(16)17-9)8-11(10)19-6-2-4-15/h7-8H,1-6H2,(H2,16,17).
What are the key properties of 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine?
5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine has a molecular weight of 335.26 g/mol, XLogP of 3.89, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-bis(3-chloropropoxy)-1,3-benzothiazol-2-amine is sourced from PubChem (CID 87533400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).