C37H42N2O6P+ — CID 87533770
6-[hydroxy-[3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]phosphoryl]oxyhexanoic acid (PubChem CID 87533770) has the molecular formula C37H42N2O6P+ and a molecular weight of 641.73 g/mol. Its IUPAC name is 6-[hydroxy-[3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]phosphoryl]oxyhexanoic acid.
| Compound Name | 6-[hydroxy-[3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]phosphoryl]oxyhexanoic acid |
|---|---|
| PubChem CID | 87533770 |
| Molecular Formula | C37H42N2O6P+ |
| Molecular Weight | 641.73 g/mol |
| Exact Mass | 641.28 |
| IUPAC Name | 6-[hydroxy-[3-(3-oxa-23-aza-9-azoniaheptacyclo[17.7.1.15,9.02,17.04,15.023,27.013,28]octacosa-1(27),2(17),4,9(28),13,15,18-heptaen-16-yl)phenyl]phosphoryl]oxyhexanoic acid |
| SMILES | O=C(O)CCCCCOP(=O)(O)c1cccc(C2=c3cc4c5c(c3Oc3c2cc2c6c3CCCN6CCC2)CCC[N+]=5CCC4)c1 |
| InChI | InChI=1S/C37H41N2O6P/c40-32(41)15-2-1-3-20-44-46(42,43)27-12-4-9-24(21-27)33-30-22-25-10-5-16-38-18-7-13-28(34(25)38)36(30)45-37-29-14-8-19-39-17-6-11-26(35(29)39)23-31(33)37/h4,9,12,21-23H,1-3,5-8,10-11,13-20H2,(H-,40,41,42,43)/p+1 |
| InChIKey | PDUCQGLWVXXIRS-UHFFFAOYSA-O |
| XLogP | 4.59 |
| TPSA | 99.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.73 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|