C20H14F12O4S2 — CID 87534092
1-[[2,3-bis(2,2,2-trifluoroethoxy)phenyl]disulfanyl]-2,3-bis(2,2,2-trifluoroethoxy)benzene (PubChem CID 87534092) has the molecular formula C20H14F12O4S2 and a molecular weight of 610.44 g/mol. Its IUPAC name is 1-[[2,3-bis(2,2,2-trifluoroethoxy)phenyl]disulfanyl]-2,3-bis(2,2,2-trifluoroethoxy)benzene.
| Compound Name | 1-[[2,3-bis(2,2,2-trifluoroethoxy)phenyl]disulfanyl]-2,3-bis(2,2,2-trifluoroethoxy)benzene |
|---|---|
| PubChem CID | 87534092 |
| Molecular Formula | C20H14F12O4S2 |
| Molecular Weight | 610.44 g/mol |
| Exact Mass | 610.01 |
| IUPAC Name | 1-[[2,3-bis(2,2,2-trifluoroethoxy)phenyl]disulfanyl]-2,3-bis(2,2,2-trifluoroethoxy)benzene |
| SMILES | FC(F)(F)COc1cccc(SSc2cccc(OCC(F)(F)F)c2OCC(F)(F)F)c1OCC(F)(F)F |
| InChI | InChI=1S/C20H14F12O4S2/c21-17(22,23)7-33-11-3-1-5-13(15(11)35-9-19(27,28)29)37-38-14-6-2-4-12(34-8-18(24,25)26)16(14)36-10-20(30,31)32/h1-6H,7-10H2 |
| InChIKey | KRCLGBRKGZCKIJ-UHFFFAOYSA-N |
| XLogP | 8.25 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.44 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|