About dibutyl(diheptyl)azanium
dibutyl(diheptyl)azanium (PubChem CID 87534229) has the molecular formula C22H48N+
and a molecular weight of 326.63 g/mol. Its IUPAC name is dibutyl(diheptyl)azanium.
Molecular Properties
| Compound Name | dibutyl(diheptyl)azanium |
| PubChem CID | 87534229 |
| Molecular Formula | C22H48N+ |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.38 |
| IUPAC Name | dibutyl(diheptyl)azanium |
| SMILES | CCCCCCC[N+](CCCC)(CCCC)CCCCCCC |
| InChI | InChI=1S/C22H48N/c1-5-9-13-15-17-21-23(19-11-7-3,20-12-8-4)22-18-16-14-10-6-2/h5-22H2,1-4H3/q+1 |
| InChIKey | BZQVYWBMOFUDTR-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dibutyl(diheptyl)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibutyl(diheptyl)azanium?
The IUPAC name of dibutyl(diheptyl)azanium (CID 87534229) is dibutyl(diheptyl)azanium.
What is the SMILES notation for dibutyl(diheptyl)azanium?
The canonical SMILES for dibutyl(diheptyl)azanium is CCCCCCC[N+](CCCC)(CCCC)CCCCCCC.
What is the InChIKey of dibutyl(diheptyl)azanium?
The InChIKey is BZQVYWBMOFUDTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H48N/c1-5-9-13-15-17-21-23(19-11-7-3,20-12-8-4)22-18-16-14-10-6-2/h5-22H2,1-4H3/q+1.
What are the key properties of dibutyl(diheptyl)azanium?
dibutyl(diheptyl)azanium has a molecular weight of 326.63 g/mol, XLogP of 7.34, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dibutyl(diheptyl)azanium is sourced from PubChem (CID 87534229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).