C22H27FN6O2S — CID 87535253
2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-1,3-benzothiazole-6-carboxylic acid (PubChem CID 87535253) has the molecular formula C22H27FN6O2S and a molecular weight of 458.56 g/mol. Its IUPAC name is 2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 87535253 |
| Molecular Formula | C22H27FN6O2S |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | 2-[[5-fluoro-4-[(1,2,2,6,6-pentamethylpiperidin-4-yl)amino]pyrimidin-2-yl]amino]-1,3-benzothiazole-6-carboxylic acid |
| SMILES | CN1C(C)(C)CC(Nc2nc(Nc3nc4ccc(C(=O)O)cc4s3)ncc2F)CC1(C)C |
| InChI | InChI=1S/C22H27FN6O2S/c1-21(2)9-13(10-22(3,4)29(21)5)25-17-14(23)11-24-19(27-17)28-20-26-15-7-6-12(18(30)31)8-16(15)32-20/h6-8,11,13H,9-10H2,1-5H3,(H,30,31)(H2,24,25,26,27,28) |
| InChIKey | RMIYZSBGXOOFAR-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 103.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |