C21H20N4O4S3 — CID 87535582
2-[2-[7-[cyanomethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]butanoic acid (PubChem CID 87535582) has the molecular formula C21H20N4O4S3 and a molecular weight of 488.62 g/mol. Its IUPAC name is 2-[2-[7-[cyanomethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]butanoic acid.
| Compound Name | 2-[2-[7-[cyanomethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]butanoic acid |
|---|---|
| PubChem CID | 87535582 |
| Molecular Formula | C21H20N4O4S3 |
| Molecular Weight | 488.62 g/mol |
| Exact Mass | 488.06 |
| IUPAC Name | 2-[2-[7-[cyanomethyl(thiophen-2-ylsulfonyl)amino]-1H-indol-2-yl]-4,5-dihydro-1,3-thiazol-5-yl]butanoic acid |
| SMILES | CCC(C(=O)O)C1CN=C(c2cc3cccc(N(CC#N)S(=O)(=O)c4cccs4)c3[nH]2)S1 |
| InChI | InChI=1S/C21H20N4O4S3/c1-2-14(21(26)27)17-12-23-20(31-17)15-11-13-5-3-6-16(19(13)24-15)25(9-8-22)32(28,29)18-7-4-10-30-18/h3-7,10-11,14,17,24H,2,9,12H2,1H3,(H,26,27) |
| InChIKey | YDRNWMHDPVJVJC-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.62 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|