C22H26F2N2O5S — CID 87535714
N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide (PubChem CID 87535714) has the molecular formula C22H26F2N2O5S and a molecular weight of 468.52 g/mol. Its IUPAC name is N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide.
| Compound Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide |
|---|---|
| PubChem CID | 87535714 |
| Molecular Formula | C22H26F2N2O5S |
| Molecular Weight | 468.52 g/mol |
| Exact Mass | 468.15 |
| IUPAC Name | N-[(2S,3R)-1-(3,5-difluorophenyl)-4-[(6-ethyl-2,2-dioxo-3,4-dihydro-1,2λ6-benzoxathiin-4-yl)amino]-3-hydroxybutan-2-yl]acetamide |
| SMILES | CCc1ccc2c(c1)C(NC[C@@H](O)[C@H](Cc1cc(F)cc(F)c1)NC(C)=O)CS(=O)(=O)O2 |
| InChI | InChI=1S/C22H26F2N2O5S/c1-3-14-4-5-22-18(8-14)20(12-32(29,30)31-22)25-11-21(28)19(26-13(2)27)9-15-6-16(23)10-17(24)7-15/h4-8,10,19-21,25,28H,3,9,11-12H2,1-2H3,(H,26,27)/t19-,20?,21+/m0/s1 |
| InChIKey | BJCMXGHALGERIJ-SIGULFFNSA-N |
| XLogP | 1.99 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.52 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|