C13H15N3O3S2 — CID 87536416
1-methoxy-4-methylbenzene;[4-(sulfinylmethyl)-1,3-thiazol-2-yl]urea (PubChem CID 87536416) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 1-methoxy-4-methylbenzene;[4-(sulfinylmethyl)-1,3-thiazol-2-yl]urea.
| Compound Name | 1-methoxy-4-methylbenzene;[4-(sulfinylmethyl)-1,3-thiazol-2-yl]urea |
|---|---|
| PubChem CID | 87536416 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 1-methoxy-4-methylbenzene;[4-(sulfinylmethyl)-1,3-thiazol-2-yl]urea |
| SMILES | COc1ccc(C)cc1.NC(=O)Nc1nc(C=S=O)cs1 |
| InChI | InChI=1S/C8H10O.C5H5N3O2S2/c1-7-3-5-8(9-2)6-4-7;6-4(9)8-5-7-3(1-11-5)2-12-10/h3-6H,1-2H3;1-2H,(H3,6,7,8,9) |
| InChIKey | ZPSCJICTMSELDV-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|