C25H17F7N6O2 — CID 87536437
[2-[4-[1-methyl-2-(2,3,4,6-tetrafluoro-5-methylanilino)benzimidazol-5-yl]oxy-2-pyridinyl]-4-(trifluoromethyl)-1H-imidazol-5-yl]methanol (PubChem CID 87536437) has the molecular formula C25H17F7N6O2 and a molecular weight of 566.44 g/mol. Its IUPAC name is [2-[4-[1-methyl-2-(2,3,4,6-tetrafluoro-5-methylanilino)benzimidazol-5-yl]oxy-2-pyridinyl]-4-(trifluoromethyl)-1H-imidazol-5-yl]methanol.
| Compound Name | [2-[4-[1-methyl-2-(2,3,4,6-tetrafluoro-5-methylanilino)benzimidazol-5-yl]oxy-2-pyridinyl]-4-(trifluoromethyl)-1H-imidazol-5-yl]methanol |
|---|---|
| PubChem CID | 87536437 |
| Molecular Formula | C25H17F7N6O2 |
| Molecular Weight | 566.44 g/mol |
| Exact Mass | 566.13 |
| IUPAC Name | [2-[4-[1-methyl-2-(2,3,4,6-tetrafluoro-5-methylanilino)benzimidazol-5-yl]oxy-2-pyridinyl]-4-(trifluoromethyl)-1H-imidazol-5-yl]methanol |
| SMILES | Cc1c(F)c(F)c(F)c(Nc2nc3cc(Oc4ccnc(-c5nc(C(F)(F)F)c(CO)[nH]5)c4)ccc3n2C)c1F |
| InChI | InChI=1S/C25H17F7N6O2/c1-10-17(26)19(28)20(29)21(18(10)27)36-24-35-13-7-11(3-4-16(13)38(24)2)40-12-5-6-33-14(8-12)23-34-15(9-39)22(37-23)25(30,31)32/h3-8,39H,9H2,1-2H3,(H,34,37)(H,35,36) |
| InChIKey | LMFKYXRONBUEBN-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.44 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|