C29H17F9O5S2 — CID 87536973
[(9-oxoxanthen-4-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87536973) has the molecular formula C29H17F9O5S2 and a molecular weight of 680.57 g/mol. Its IUPAC name is [(9-oxoxanthen-4-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(9-oxoxanthen-4-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87536973 |
| Molecular Formula | C29H17F9O5S2 |
| Molecular Weight | 680.57 g/mol |
| Exact Mass | 680.04 |
| IUPAC Name | [(9-oxoxanthen-4-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | O=c1c2ccccc2oc2c(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c3ccccc3)c3ccccc3)cccc12 |
| InChI | InChI=1S/C29H17F9O5S2/c30-26(31,28(34,35)36)27(32,33)29(37,38)45(40,41)43-44(18-10-3-1-4-11-18,19-12-5-2-6-13-19)23-17-9-15-21-24(39)20-14-7-8-16-22(20)42-25(21)23/h1-17H |
| InChIKey | PYYOGVUKLHPSBQ-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.57 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|