About bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate
bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate (PubChem CID 87537061) has the molecular formula C24H19F3O5S2
and a molecular weight of 508.54 g/mol. Its IUPAC name is bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate |
| PubChem CID | 87537061 |
| Molecular Formula | C24H19F3O5S2 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.06 |
| IUPAC Name | bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate |
| SMILES | Cc1ccc([S+](c2ccc(C)cc2)c2ccc3ccc(=O)oc3c2)cc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C23H19O2S.CHF3O3S/c1-16-3-9-19(10-4-16)26(20-11-5-17(2)6-12-20)21-13-7-18-8-14-23(24)25-22(18)15-21;2-1(3,4)8(5,6)7/h3-15H,1-2H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | ROPRNLUYKGVROL-UHFFFAOYSA-M |
| XLogP | 5.56 |
| TPSA | 87.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate?
The IUPAC name of bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate (CID 87537061) is bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate.
What is the SMILES notation for bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate?
The canonical SMILES for bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate is Cc1ccc([S+](c2ccc(C)cc2)c2ccc3ccc(=O)oc3c2)cc1.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate?
The InChIKey is ROPRNLUYKGVROL-UHFFFAOYSA-M. The full InChI is InChI=1S/C23H19O2S.CHF3O3S/c1-16-3-9-19(10-4-16)26(20-11-5-17(2)6-12-20)21-13-7-18-8-14-23(24)25-22(18)15-21;2-1(3,4)8(5,6)7/h3-15H,1-2H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate?
bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate has a molecular weight of 508.54 g/mol, XLogP of 5.56, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(4-methylphenyl)-(2-oxochromen-7-yl)sulfanium;trifluoromethanesulfonate is sourced from PubChem (CID 87537061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).