C33H15F23O4S — CID 87537096
[(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate (PubChem CID 87537096) has the molecular formula C33H15F23O4S and a molecular weight of 944.50 g/mol. Its IUPAC name is [(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate.
| Compound Name | [(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate |
|---|---|
| PubChem CID | 87537096 |
| Molecular Formula | C33H15F23O4S |
| Molecular Weight | 944.50 g/mol |
| Exact Mass | 944.03 |
| IUPAC Name | [(2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-tricosafluorododecanoate |
| SMILES | O=C(OS(c1ccccc1)(c1ccccc1)c1ccc2ccc(=O)oc2c1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C33H15F23O4S/c34-23(35,22(58)60-61(17-7-3-1-4-8-17,18-9-5-2-6-10-18)19-13-11-16-12-14-21(57)59-20(16)15-19)24(36,37)25(38,39)26(40,41)27(42,43)28(44,45)29(46,47)30(48,49)31(50,51)32(52,53)33(54,55)56/h1-15H |
| InChIKey | AYYIUSMSOCOKRZ-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.50 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|