C33H17F17O5S2 — CID 87537111
[(9-oxoxanthen-2-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate (PubChem CID 87537111) has the molecular formula C33H17F17O5S2 and a molecular weight of 880.59 g/mol. Its IUPAC name is [(9-oxoxanthen-2-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate.
| Compound Name | [(9-oxoxanthen-2-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
|---|---|
| PubChem CID | 87537111 |
| Molecular Formula | C33H17F17O5S2 |
| Molecular Weight | 880.59 g/mol |
| Exact Mass | 880.02 |
| IUPAC Name | [(9-oxoxanthen-2-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-heptadecafluorooctane-1-sulfonate |
| SMILES | O=c1c2ccccc2oc2ccc(S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c3ccccc3)c3ccccc3)cc12 |
| InChI | InChI=1S/C33H17F17O5S2/c34-26(35,28(38,39)30(42,43)32(46,47)48)27(36,37)29(40,41)31(44,45)33(49,50)57(52,53)55-56(18-9-3-1-4-10-18,19-11-5-2-6-12-19)20-15-16-24-22(17-20)25(51)21-13-7-8-14-23(21)54-24/h1-17H |
| InChIKey | JFSKCWBKTPRPDB-UHFFFAOYSA-N |
| XLogP | 11.46 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 880.59 |
| LogP ≤ 5 | 11.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|