About (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde
(3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde (PubChem CID 87537611) has the molecular formula C9H6F2O
and a molecular weight of 168.14 g/mol. Its IUPAC name is (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde.
Molecular Properties
| Compound Name | (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde |
| PubChem CID | 87537611 |
| Molecular Formula | C9H6F2O |
| Molecular Weight | 168.14 g/mol |
| Exact Mass | 168.04 |
| IUPAC Name | (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde |
| SMILES | O=Cc1ccc(=C\F)/c(=C\F)c1 |
| InChI | InChI=1S/C9H6F2O/c10-4-8-2-1-7(6-12)3-9(8)5-11/h1-6H/b8-4+,9-5- |
| InChIKey | QFBMGJAVZKCXOW-HXGSSHHBSA-N |
| XLogP | 0.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.14 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde?
The IUPAC name of (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde (CID 87537611) is (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde.
What is the SMILES notation for (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde?
The canonical SMILES for (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde is O=Cc1ccc(=C\F)/c(=C\F)c1.
What is the InChIKey of (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde?
The InChIKey is QFBMGJAVZKCXOW-HXGSSHHBSA-N. The full InChI is InChI=1S/C9H6F2O/c10-4-8-2-1-7(6-12)3-9(8)5-11/h1-6H/b8-4+,9-5-.
What are the key properties of (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde?
(3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde has a molecular weight of 168.14 g/mol, XLogP of 0.91, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z,4E)-3,4-bis(fluoromethylidene)cyclohexa-1,5-diene-1-carbaldehyde is sourced from PubChem (CID 87537611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).