C26H17F9O5S2 — CID 87537653
[(6-methyl-2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate (PubChem CID 87537653) has the molecular formula C26H17F9O5S2 and a molecular weight of 644.53 g/mol. Its IUPAC name is [(6-methyl-2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate.
| Compound Name | [(6-methyl-2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
|---|---|
| PubChem CID | 87537653 |
| Molecular Formula | C26H17F9O5S2 |
| Molecular Weight | 644.53 g/mol |
| Exact Mass | 644.04 |
| IUPAC Name | [(6-methyl-2-oxochromen-7-yl)-diphenyl-λ4-sulfanyl] 1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonate |
| SMILES | Cc1cc2ccc(=O)oc2cc1S(OS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C26H17F9O5S2/c1-16-14-17-12-13-22(36)39-20(17)15-21(16)41(18-8-4-2-5-9-18,19-10-6-3-7-11-19)40-42(37,38)26(34,35)24(29,30)23(27,28)25(31,32)33/h2-15H,1H3 |
| InChIKey | LGCGORQYERIGLH-UHFFFAOYSA-N |
| XLogP | 8.07 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.53 |
| LogP ≤ 5 | 8.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|