C23H20ClF6N3O2 — CID 87538101
2-chloro-5-[(7-fluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol (PubChem CID 87538101) has the molecular formula C23H20ClF6N3O2 and a molecular weight of 519.87 g/mol. Its IUPAC name is 2-chloro-5-[(7-fluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol.
| Compound Name | 2-chloro-5-[(7-fluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol |
|---|---|
| PubChem CID | 87538101 |
| Molecular Formula | C23H20ClF6N3O2 |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | 2-chloro-5-[(7-fluoro-2-methylquinazolin-5-yl)amino]-8,8-dimethyl-6-(1,1,2,2,2-pentafluoroethyl)-5,7-dihydronaphthalene-1,6-diol |
| SMILES | Cc1ncc2c(NC3c4ccc(Cl)c(O)c4C(C)(C)CC3(O)C(F)(F)C(F)(F)F)cc(F)cc2n1 |
| InChI | InChI=1S/C23H20ClF6N3O2/c1-10-31-8-13-15(32-10)6-11(25)7-16(13)33-19-12-4-5-14(24)18(34)17(12)20(2,3)9-21(19,35)22(26,27)23(28,29)30/h4-8,19,33-35H,9H2,1-3H3 |
| InChIKey | XNTOQSAWEAQLCH-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 78.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|