C10H6F4O2 — CID 87538226
2-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxine (PubChem CID 87538226) has the molecular formula C10H6F4O2 and a molecular weight of 234.15 g/mol. Its IUPAC name is 2-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxine.
| Compound Name | 2-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxine |
|---|---|
| PubChem CID | 87538226 |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.15 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 2-(5,5,6,6-tetrafluorocyclohexa-1,3-dien-1-yl)-1,4-dioxine |
| SMILES | FC1(F)C=CC=C(C2=COC=CO2)C1(F)F |
| InChI | InChI=1S/C10H6F4O2/c11-9(12)3-1-2-7(10(9,13)14)8-6-15-4-5-16-8/h1-6H |
| InChIKey | AJZOLNAAJIVSHH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.15 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|