C23H20ClF4N5O3S — CID 87538687
(3-chloro-2-fluorophenyl)-[(1S,4S)-5-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone;2,2,2-trifluoroacetic acid (PubChem CID 87538687) has the molecular formula C23H20ClF4N5O3S and a molecular weight of 557.96 g/mol. Its IUPAC name is (3-chloro-2-fluorophenyl)-[(1S,4S)-5-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone;2,2,2-trifluoroacetic acid.
| Compound Name | (3-chloro-2-fluorophenyl)-[(1S,4S)-5-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 87538687 |
| Molecular Formula | C23H20ClF4N5O3S |
| Molecular Weight | 557.96 g/mol |
| Exact Mass | 557.09 |
| IUPAC Name | (3-chloro-2-fluorophenyl)-[(1S,4S)-5-[[6-(1,3-thiazol-2-ylamino)-2-pyridinyl]methyl]-2,5-diazabicyclo[2.2.1]heptan-2-yl]methanone;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(c1cccc(Cl)c1F)N1C[C@@H]2C[C@H]1CN2Cc1cccc(Nc2nccs2)n1 |
| InChI | InChI=1S/C21H19ClFN5OS.C2HF3O2/c22-17-5-2-4-16(19(17)23)20(29)28-12-14-9-15(28)11-27(14)10-13-3-1-6-18(25-13)26-21-24-7-8-30-21;3-2(4,5)1(6)7/h1-8,14-15H,9-12H2,(H,24,25,26);(H,6,7)/t14-,15-;/m0./s1 |
| InChIKey | LHHHIXFLGVOGDS-YYLIZZNMSA-N |
| XLogP | 4.81 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.96 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |