C12H20N6OS2 — CID 87539065
2-(diaminomethylideneamino)-N-(1-methoxypropan-2-yl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbothioamide (PubChem CID 87539065) has the molecular formula C12H20N6OS2 and a molecular weight of 328.47 g/mol. Its IUPAC name is 2-(diaminomethylideneamino)-N-(1-methoxypropan-2-yl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbothioamide.
| Compound Name | 2-(diaminomethylideneamino)-N-(1-methoxypropan-2-yl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbothioamide |
|---|---|
| PubChem CID | 87539065 |
| Molecular Formula | C12H20N6OS2 |
| Molecular Weight | 328.47 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 2-(diaminomethylideneamino)-N-(1-methoxypropan-2-yl)-6,7-dihydro-4H-[1,3]thiazolo[5,4-c]pyridine-5-carbothioamide |
| SMILES | COCC(C)NC(=S)N1CCc2nc(N=C(N)N)sc2C1 |
| InChI | InChI=1S/C12H20N6OS2/c1-7(6-19-2)15-12(20)18-4-3-8-9(5-18)21-11(16-8)17-10(13)14/h7H,3-6H2,1-2H3,(H,15,20)(H4,13,14,16,17) |
| InChIKey | GOJROTMNJNWGMG-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 101.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.47 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|