C18H21NO6 — CID 87539411
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid (PubChem CID 87539411) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid |
|---|---|
| PubChem CID | 87539411 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-oxopentanedioic acid |
| SMILES | O=C(O)CCC(=O)C(=O)O.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.C5H6O5/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;6-3(5(9)10)1-2-4(7)8/h1-4,8,10,13-15H,5-7H2;1-2H2,(H,7,8)(H,9,10) |
| InChIKey | NMSPUKIWTJLSNA-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 123.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|