C19H23NO8 — CID 87539525
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87539525) has the molecular formula C19H23NO8 and a molecular weight of 393.39 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87539525 |
| Molecular Formula | C19H23NO8 |
| Molecular Weight | 393.39 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.C6H8O7/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;7-3(8)1-6(13,5(11)12)2-4(9)10/h1-4,8,10,13-15H,5-7H2;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | ZYTNUNICZBESHS-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 164.39 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.39 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |