C11H18N4O2S — CID 87539570
2-(5,5-dimethyl-6,7-dihydro-4H-1,3-benzothiazol-2-yl)guanidine;formic acid (PubChem CID 87539570) has the molecular formula C11H18N4O2S and a molecular weight of 270.36 g/mol. Its IUPAC name is 2-(5,5-dimethyl-6,7-dihydro-4H-1,3-benzothiazol-2-yl)guanidine;formic acid.
| Compound Name | 2-(5,5-dimethyl-6,7-dihydro-4H-1,3-benzothiazol-2-yl)guanidine;formic acid |
|---|---|
| PubChem CID | 87539570 |
| Molecular Formula | C11H18N4O2S |
| Molecular Weight | 270.36 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 2-(5,5-dimethyl-6,7-dihydro-4H-1,3-benzothiazol-2-yl)guanidine;formic acid |
| SMILES | CC1(C)CCc2sc(N=C(N)N)nc2C1.O=CO |
| InChI | InChI=1S/C10H16N4S.CH2O2/c1-10(2)4-3-7-6(5-10)13-9(15-7)14-8(11)12;2-1-3/h3-5H2,1-2H3,(H4,11,12,13,14);1H,(H,2,3) |
| InChIKey | NBVSGOWAFKNJHA-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 114.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.36 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|