C24H26N4O7S — CID 87540024
2-[4-[4-[[5-(3-methylsulfonyloxyanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid (PubChem CID 87540024) has the molecular formula C24H26N4O7S and a molecular weight of 514.56 g/mol. Its IUPAC name is 2-[4-[4-[[5-(3-methylsulfonyloxyanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid.
| Compound Name | 2-[4-[4-[[5-(3-methylsulfonyloxyanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid |
|---|---|
| PubChem CID | 87540024 |
| Molecular Formula | C24H26N4O7S |
| Molecular Weight | 514.56 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | 2-[4-[4-[[5-(3-methylsulfonyloxyanilino)-1,3,4-oxadiazole-2-carbonyl]amino]phenyl]cyclohexyl]acetic acid |
| SMILES | CS(=O)(=O)Oc1cccc(Nc2nnc(C(=O)Nc3ccc(C4CCC(CC(=O)O)CC4)cc3)o2)c1 |
| InChI | InChI=1S/C24H26N4O7S/c1-36(32,33)35-20-4-2-3-19(14-20)26-24-28-27-23(34-24)22(31)25-18-11-9-17(10-12-18)16-7-5-15(6-8-16)13-21(29)30/h2-4,9-12,14-16H,5-8,13H2,1H3,(H,25,31)(H,26,28)(H,29,30) |
| InChIKey | KNCJCILMVZKORO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 160.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.56 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|