C21H15F3N2O5 — CID 87540052
[2-oxo-3-[1-oxo-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-7-yl]-1,3-oxazolidin-5-yl]methyl formate (PubChem CID 87540052) has the molecular formula C21H15F3N2O5 and a molecular weight of 432.35 g/mol. Its IUPAC name is [2-oxo-3-[1-oxo-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-7-yl]-1,3-oxazolidin-5-yl]methyl formate.
| Compound Name | [2-oxo-3-[1-oxo-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-7-yl]-1,3-oxazolidin-5-yl]methyl formate |
|---|---|
| PubChem CID | 87540052 |
| Molecular Formula | C21H15F3N2O5 |
| Molecular Weight | 432.35 g/mol |
| Exact Mass | 432.09 |
| IUPAC Name | [2-oxo-3-[1-oxo-3-[2-(trifluoromethyl)phenyl]-2H-isoquinolin-7-yl]-1,3-oxazolidin-5-yl]methyl formate |
| SMILES | O=COCC1CN(c2ccc3cc(-c4ccccc4C(F)(F)F)[nH]c(=O)c3c2)C(=O)O1 |
| InChI | InChI=1S/C21H15F3N2O5/c22-21(23,24)17-4-2-1-3-15(17)18-7-12-5-6-13(8-16(12)19(28)25-18)26-9-14(10-30-11-27)31-20(26)29/h1-8,11,14H,9-10H2,(H,25,28) |
| InChIKey | JRFWOBOGUONHPL-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 88.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|