About 4-oxo-1,3-thiazolidine-2-carboxamide
4-oxo-1,3-thiazolidine-2-carboxamide (PubChem CID 87540653) has the molecular formula C4H6N2O2S
and a molecular weight of 146.17 g/mol. Its IUPAC name is 4-oxo-1,3-thiazolidine-2-carboxamide.
Molecular Properties
| Compound Name | 4-oxo-1,3-thiazolidine-2-carboxamide |
| PubChem CID | 87540653 |
| Molecular Formula | C4H6N2O2S |
| Molecular Weight | 146.17 g/mol |
| Exact Mass | 146.01 |
| IUPAC Name | 4-oxo-1,3-thiazolidine-2-carboxamide |
| SMILES | NC(=O)C1NC(=O)CS1 |
| InChI | InChI=1S/C4H6N2O2S/c5-3(8)4-6-2(7)1-9-4/h4H,1H2,(H2,5,8)(H,6,7) |
| InChIKey | QEFFLIKQBYHBAV-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.17 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-oxo-1,3-thiazolidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-1,3-thiazolidine-2-carboxamide?
The IUPAC name of 4-oxo-1,3-thiazolidine-2-carboxamide (CID 87540653) is 4-oxo-1,3-thiazolidine-2-carboxamide.
What is the SMILES notation for 4-oxo-1,3-thiazolidine-2-carboxamide?
The canonical SMILES for 4-oxo-1,3-thiazolidine-2-carboxamide is NC(=O)C1NC(=O)CS1.
What is the InChIKey of 4-oxo-1,3-thiazolidine-2-carboxamide?
The InChIKey is QEFFLIKQBYHBAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2O2S/c5-3(8)4-6-2(7)1-9-4/h4H,1H2,(H2,5,8)(H,6,7).
What are the key properties of 4-oxo-1,3-thiazolidine-2-carboxamide?
4-oxo-1,3-thiazolidine-2-carboxamide has a molecular weight of 146.17 g/mol, XLogP of -1.34, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-1,3-thiazolidine-2-carboxamide is sourced from PubChem (CID 87540653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).