C8H7F6NO4S — CID 87540910
[1-(2,2,2-trifluoroacetyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate (PubChem CID 87540910) has the molecular formula C8H7F6NO4S and a molecular weight of 327.20 g/mol. Its IUPAC name is [1-(2,2,2-trifluoroacetyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate.
| Compound Name | [1-(2,2,2-trifluoroacetyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87540910 |
| Molecular Formula | C8H7F6NO4S |
| Molecular Weight | 327.20 g/mol |
| Exact Mass | 327.00 |
| IUPAC Name | [1-(2,2,2-trifluoroacetyl)-3,6-dihydro-2H-pyridin-4-yl] trifluoromethanesulfonate |
| SMILES | O=C(N1CC=C(OS(=O)(=O)C(F)(F)F)CC1)C(F)(F)F |
| InChI | InChI=1S/C8H7F6NO4S/c9-7(10,11)6(16)15-3-1-5(2-4-15)19-20(17,18)8(12,13)14/h1H,2-4H2 |
| InChIKey | YZMFXBKPUMXFFK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.20 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|