About N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium
N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium (PubChem CID 87541078) has the molecular formula C13H12N5O+
and a molecular weight of 254.27 g/mol. Its IUPAC name is N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium.
Molecular Properties
| Compound Name | N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium |
| PubChem CID | 87541078 |
| Molecular Formula | C13H12N5O+ |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium |
| SMILES | O[N+]#CC1=CCC(n2ccnc2)(n2ccnc2)C=C1 |
| InChI | InChI=1S/C13H11N5O/c19-16-9-12-1-3-13(4-2-12,17-7-5-14-10-17)18-8-6-15-11-18/h1-3,5-8,10-11H,4H2/p+1 |
| InChIKey | LVNMJZGMMMQXML-UHFFFAOYSA-O |
| XLogP | 1.89 |
| TPSA | 60.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium?
The IUPAC name of N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium (CID 87541078) is N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium.
What is the SMILES notation for N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium?
The canonical SMILES for N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium is O[N+]#CC1=CCC(n2ccnc2)(n2ccnc2)C=C1.
What is the InChIKey of N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium?
The InChIKey is LVNMJZGMMMQXML-UHFFFAOYSA-O. The full InChI is InChI=1S/C13H11N5O/c19-16-9-12-1-3-13(4-2-12,17-7-5-14-10-17)18-8-6-15-11-18/h1-3,5-8,10-11H,4H2/p+1.
What are the key properties of N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium?
N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium has a molecular weight of 254.27 g/mol, XLogP of 1.89, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-4,4-di(imidazol-1-yl)cyclohexa-1,5-diene-1-carbonitrilium is sourced from PubChem (CID 87541078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).