C30H22F3N3O6S — CID 87541429
(2,2,2-trifluoroacetyl) 2-amino-5-[3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]benzoate (PubChem CID 87541429) has the molecular formula C30H22F3N3O6S and a molecular weight of 609.58 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 2-amino-5-[3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]benzoate.
| Compound Name | (2,2,2-trifluoroacetyl) 2-amino-5-[3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]benzoate |
|---|---|
| PubChem CID | 87541429 |
| Molecular Formula | C30H22F3N3O6S |
| Molecular Weight | 609.58 g/mol |
| Exact Mass | 609.12 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 2-amino-5-[3-(2-methoxyphenyl)-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-5-yl]benzoate |
| SMILES | COc1ccccc1-c1cn(S(=O)(=O)c2ccc(C)cc2)c2ncc(-c3ccc(N)c(C(=O)OC(=O)C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C30H22F3N3O6S/c1-17-7-10-20(11-8-17)43(39,40)36-16-24(21-5-3-4-6-26(21)41-2)22-14-19(15-35-27(22)36)18-9-12-25(34)23(13-18)28(37)42-29(38)30(31,32)33/h3-16H,34H2,1-2H3 |
| InChIKey | XLOMMTFYXKRABW-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 130.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.58 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|