C22H18Cl3F3N4O4S — CID 87541446
3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione (PubChem CID 87541446) has the molecular formula C22H18Cl3F3N4O4S and a molecular weight of 597.83 g/mol. Its IUPAC name is 3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione.
| Compound Name | 3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
|---|---|
| PubChem CID | 87541446 |
| Molecular Formula | C22H18Cl3F3N4O4S |
| Molecular Weight | 597.83 g/mol |
| Exact Mass | 596.01 |
| IUPAC Name | 3-amino-6-[(4-chlorophenyl)methyl]-1-(2,4-dichlorophenyl)sulfonyl-8-(2,2,2-trifluoroethyl)-3,6-dihydro-2H-pyrazino[1,2-a]pyrimidine-4,7-dione |
| SMILES | NC1CN(S(=O)(=O)c2ccc(Cl)cc2Cl)C2=CN(CC(F)(F)F)C(=O)C(Cc3ccc(Cl)cc3)N2C1=O |
| InChI | InChI=1S/C22H18Cl3F3N4O4S/c23-13-3-1-12(2-4-13)7-17-21(34)30(11-22(26,27)28)10-19-31(9-16(29)20(33)32(17)19)37(35,36)18-6-5-14(24)8-15(18)25/h1-6,8,10,16-17H,7,9,11,29H2 |
| InChIKey | GFPRGLNWBFACBB-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 104.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 597.83 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |