C18H23NO5 — CID 87542087
tert-butyl N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-N-(2-oxoethyl)carbamate (PubChem CID 87542087) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is tert-butyl N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-N-(2-oxoethyl)carbamate.
| Compound Name | tert-butyl N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-N-(2-oxoethyl)carbamate |
|---|---|
| PubChem CID | 87542087 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | tert-butyl N-[cyclohexa-1,3-dien-1-yl(1,4-dioxin-2-yl)methyl]-N-(2-oxoethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC=O)C(C1=CC=CCC1)C1=COC=CO1 |
| InChI | InChI=1S/C18H23NO5/c1-18(2,3)24-17(21)19(9-10-20)16(14-7-5-4-6-8-14)15-13-22-11-12-23-15/h4-5,7,10-13,16H,6,8-9H2,1-3H3 |
| InChIKey | QIRZONDSKIARCD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|