About 4-chloro-2H-furo[3,2-b]pyridine
4-chloro-2H-furo[3,2-b]pyridine (PubChem CID 87542445) has the molecular formula C7H6ClNO
and a molecular weight of 155.58 g/mol. Its IUPAC name is 4-chloro-2H-furo[3,2-b]pyridine.
Molecular Properties
| Compound Name | 4-chloro-2H-furo[3,2-b]pyridine |
| PubChem CID | 87542445 |
| Molecular Formula | C7H6ClNO |
| Molecular Weight | 155.58 g/mol |
| Exact Mass | 155.01 |
| IUPAC Name | 4-chloro-2H-furo[3,2-b]pyridine |
| SMILES | ClN1C=CC=C2OCC=C21 |
| InChI | InChI=1S/C7H6ClNO/c8-9-4-1-2-7-6(9)3-5-10-7/h1-4H,5H2 |
| InChIKey | GOGJXGGEWYKEDN-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.58 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2H-furo[3,2-b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2H-furo[3,2-b]pyridine?
The IUPAC name of 4-chloro-2H-furo[3,2-b]pyridine (CID 87542445) is 4-chloro-2H-furo[3,2-b]pyridine.
What is the SMILES notation for 4-chloro-2H-furo[3,2-b]pyridine?
The canonical SMILES for 4-chloro-2H-furo[3,2-b]pyridine is ClN1C=CC=C2OCC=C21.
What is the InChIKey of 4-chloro-2H-furo[3,2-b]pyridine?
The InChIKey is GOGJXGGEWYKEDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6ClNO/c8-9-4-1-2-7-6(9)3-5-10-7/h1-4H,5H2.
What are the key properties of 4-chloro-2H-furo[3,2-b]pyridine?
4-chloro-2H-furo[3,2-b]pyridine has a molecular weight of 155.58 g/mol, XLogP of 1.77, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2H-furo[3,2-b]pyridine is sourced from PubChem (CID 87542445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).