C3H3F6NO2S — CID 87542493
N,1,1,3,3,3-hexafluoropropane-1-sulfonamide (PubChem CID 87542493) has the molecular formula C3H3F6NO2S and a molecular weight of 231.12 g/mol. Its IUPAC name is N,1,1,3,3,3-hexafluoropropane-1-sulfonamide.
| Compound Name | N,1,1,3,3,3-hexafluoropropane-1-sulfonamide |
|---|---|
| PubChem CID | 87542493 |
| Molecular Formula | C3H3F6NO2S |
| Molecular Weight | 231.12 g/mol |
| Exact Mass | 230.98 |
| IUPAC Name | N,1,1,3,3,3-hexafluoropropane-1-sulfonamide |
| SMILES | O=S(=O)(NF)C(F)(F)CC(F)(F)F |
| InChI | InChI=1S/C3H3F6NO2S/c4-2(5,6)1-3(7,8)13(11,12)10-9/h10H,1H2 |
| InChIKey | BMJUJZDUZAIRGD-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.12 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|