C17H14F7N3O — CID 87542760
N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-N'-methylpyridine-4-carbohydrazide (PubChem CID 87542760) has the molecular formula C17H14F7N3O and a molecular weight of 409.31 g/mol. Its IUPAC name is N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-N'-methylpyridine-4-carbohydrazide.
| Compound Name | N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-N'-methylpyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 87542760 |
| Molecular Formula | C17H14F7N3O |
| Molecular Weight | 409.31 g/mol |
| Exact Mass | 409.10 |
| IUPAC Name | N-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)phenyl]methyl]-N'-methylpyridine-4-carbohydrazide |
| SMILES | CNN(Cc1ccc(C(F)(C(F)(F)F)C(F)(F)F)cc1)C(=O)c1ccncc1 |
| InChI | InChI=1S/C17H14F7N3O/c1-25-27(14(28)12-6-8-26-9-7-12)10-11-2-4-13(5-3-11)15(18,16(19,20)21)17(22,23)24/h2-9,25H,10H2,1H3 |
| InChIKey | UVGMOVUQSJTJGH-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|