C25H24N4O2 — CID 87542960
(2S)-1-N-[(7-ethynylnaphthalen-1-yl)methyl]-2-N-(pyridin-4-ylmethyl)pyrrolidine-1,2-dicarboxamide (PubChem CID 87542960) has the molecular formula C25H24N4O2 and a molecular weight of 412.49 g/mol. Its IUPAC name is (2S)-1-N-[(7-ethynylnaphthalen-1-yl)methyl]-2-N-(pyridin-4-ylmethyl)pyrrolidine-1,2-dicarboxamide.
| Compound Name | (2S)-1-N-[(7-ethynylnaphthalen-1-yl)methyl]-2-N-(pyridin-4-ylmethyl)pyrrolidine-1,2-dicarboxamide |
|---|---|
| PubChem CID | 87542960 |
| Molecular Formula | C25H24N4O2 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.19 |
| IUPAC Name | (2S)-1-N-[(7-ethynylnaphthalen-1-yl)methyl]-2-N-(pyridin-4-ylmethyl)pyrrolidine-1,2-dicarboxamide |
| SMILES | C#Cc1ccc2cccc(CNC(=O)N3CCC[C@H]3C(=O)NCc3ccncc3)c2c1 |
| InChI | InChI=1S/C25H24N4O2/c1-2-18-8-9-20-5-3-6-21(22(20)15-18)17-28-25(31)29-14-4-7-23(29)24(30)27-16-19-10-12-26-13-11-19/h1,3,5-6,8-13,15,23H,4,7,14,16-17H2,(H,27,30)(H,28,31)/t23-/m0/s1 |
| InChIKey | TXOPJLCSWUMDBX-QHCPKHFHSA-N |
| XLogP | 3.21 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|