C21H31N7O2 — CID 87543250
4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-N-ethyl-N,6-dimethylquinazoline-2-carboxamide (PubChem CID 87543250) has the molecular formula C21H31N7O2 and a molecular weight of 413.53 g/mol. Its IUPAC name is 4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-N-ethyl-N,6-dimethylquinazoline-2-carboxamide.
| Compound Name | 4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-N-ethyl-N,6-dimethylquinazoline-2-carboxamide |
|---|---|
| PubChem CID | 87543250 |
| Molecular Formula | C21H31N7O2 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | 4-[[(1S,2R)-2-[[amino-(methoxyamino)methylidene]amino]cyclohexyl]amino]-N-ethyl-N,6-dimethylquinazoline-2-carboxamide |
| SMILES | CCN(C)C(=O)c1nc(N[C@H]2CCCCC2/N=C(\N)NOC)c2cc(C)ccc2n1 |
| InChI | InChI=1S/C21H31N7O2/c1-5-28(3)20(29)19-23-15-11-10-13(2)12-14(15)18(26-19)24-16-8-6-7-9-17(16)25-21(22)27-30-4/h10-12,16-17H,5-9H2,1-4H3,(H3,22,25,27)(H,23,24,26)/t16-,17?/m0/s1 |
| InChIKey | DKQHROGKPWKTOI-BHWOMJMDSA-N |
| XLogP | 2.22 |
| TPSA | 117.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|