C17H14BrN3O5 — CID 87543344
5-[2-(2-bromo-4,5,6-trimethyl-3-pyridinyl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol (PubChem CID 87543344) has the molecular formula C17H14BrN3O5 and a molecular weight of 420.22 g/mol. Its IUPAC name is 5-[2-(2-bromo-4,5,6-trimethyl-3-pyridinyl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol.
| Compound Name | 5-[2-(2-bromo-4,5,6-trimethyl-3-pyridinyl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol |
|---|---|
| PubChem CID | 87543344 |
| Molecular Formula | C17H14BrN3O5 |
| Molecular Weight | 420.22 g/mol |
| Exact Mass | 419.01 |
| IUPAC Name | 5-[2-(2-bromo-4,5,6-trimethyl-3-pyridinyl)-1,3-oxazol-4-yl]-3-nitrobenzene-1,2-diol |
| SMILES | Cc1nc(Br)c(-c2nc(-c3cc(O)c(O)c([N+](=O)[O-])c3)co2)c(C)c1C |
| InChI | InChI=1S/C17H14BrN3O5/c1-7-8(2)14(16(18)19-9(7)3)17-20-11(6-26-17)10-4-12(21(24)25)15(23)13(22)5-10/h4-6,22-23H,1-3H3 |
| InChIKey | VKSPFBDUNOLPHI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.22 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|