C22H22N4O2 — CID 87543590
N-[(1S)-1-(oxiran-2-yl)-2-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]ethyl]acetamide (PubChem CID 87543590) has the molecular formula C22H22N4O2 and a molecular weight of 374.44 g/mol. Its IUPAC name is N-[(1S)-1-(oxiran-2-yl)-2-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]ethyl]acetamide.
| Compound Name | N-[(1S)-1-(oxiran-2-yl)-2-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 87543590 |
| Molecular Formula | C22H22N4O2 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | N-[(1S)-1-(oxiran-2-yl)-2-[4-[(6-phenylpyrimidin-4-yl)amino]phenyl]ethyl]acetamide |
| SMILES | CC(=O)N[C@@H](Cc1ccc(Nc2cc(-c3ccccc3)ncn2)cc1)C1CO1 |
| InChI | InChI=1S/C22H22N4O2/c1-15(27)25-20(21-13-28-21)11-16-7-9-18(10-8-16)26-22-12-19(23-14-24-22)17-5-3-2-4-6-17/h2-10,12,14,20-21H,11,13H2,1H3,(H,25,27)(H,23,24,26)/t20-,21?/m0/s1 |
| InChIKey | PYBJBEPYOMDKDJ-BGERDNNASA-N |
| XLogP | 3.33 |
| TPSA | 79.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|