C19H16Br2N2O2 — CID 87543954
4-[6-bromo-7-(bromomethyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl]-N,N-dimethylaniline (PubChem CID 87543954) has the molecular formula C19H16Br2N2O2 and a molecular weight of 464.16 g/mol. Its IUPAC name is 4-[6-bromo-7-(bromomethyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl]-N,N-dimethylaniline.
| Compound Name | 4-[6-bromo-7-(bromomethyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl]-N,N-dimethylaniline |
|---|---|
| PubChem CID | 87543954 |
| Molecular Formula | C19H16Br2N2O2 |
| Molecular Weight | 464.16 g/mol |
| Exact Mass | 461.96 |
| IUPAC Name | 4-[6-bromo-7-(bromomethyl)-[1,3]dioxolo[4,5-g]quinolin-8-yl]-N,N-dimethylaniline |
| SMILES | CN(C)c1ccc(-c2c(CBr)c(Br)nc3cc4c(cc23)OCO4)cc1 |
| InChI | InChI=1S/C19H16Br2N2O2/c1-23(2)12-5-3-11(4-6-12)18-13-7-16-17(25-10-24-16)8-15(13)22-19(21)14(18)9-20/h3-8H,9-10H2,1-2H3 |
| InChIKey | PACNFWFMXRYHMJ-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.16 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|