C34H34F5N7O2 — CID 87544351
N-[3-[8-(2,6-difluorophenyl)-2-[3-(N-methylanilino)propylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methylphenyl]-2,2,2-trifluoro-N-propan-2-ylacetamide (PubChem CID 87544351) has the molecular formula C34H34F5N7O2 and a molecular weight of 667.68 g/mol. Its IUPAC name is N-[3-[8-(2,6-difluorophenyl)-2-[3-(N-methylanilino)propylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methylphenyl]-2,2,2-trifluoro-N-propan-2-ylacetamide.
| Compound Name | N-[3-[8-(2,6-difluorophenyl)-2-[3-(N-methylanilino)propylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methylphenyl]-2,2,2-trifluoro-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 87544351 |
| Molecular Formula | C34H34F5N7O2 |
| Molecular Weight | 667.68 g/mol |
| Exact Mass | 667.27 |
| IUPAC Name | N-[3-[8-(2,6-difluorophenyl)-2-[3-(N-methylanilino)propylamino]-7-oxo-5,6-dihydropyrimido[4,5-d]pyrimidin-4-yl]-4-methylphenyl]-2,2,2-trifluoro-N-propan-2-ylacetamide |
| SMILES | Cc1ccc(N(C(=O)C(F)(F)F)C(C)C)cc1-c1nc(NCCCN(C)c2ccccc2)nc2c1CNC(=O)N2c1c(F)cccc1F |
| InChI | InChI=1S/C34H34F5N7O2/c1-20(2)45(31(47)34(37,38)39)23-15-14-21(3)24(18-23)28-25-19-41-33(48)46(29-26(35)12-8-13-27(29)36)30(25)43-32(42-28)40-16-9-17-44(4)22-10-6-5-7-11-22/h5-8,10-15,18,20H,9,16-17,19H2,1-4H3,(H,41,48)(H,40,42,43) |
| InChIKey | BARUQSBOCYJLIF-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 93.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.68 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|