About (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid
(2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid (PubChem CID 87544745) has the molecular formula C15H14Cl2N2O4S
and a molecular weight of 389.26 g/mol. Its IUPAC name is (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid.
Molecular Properties
| Compound Name | (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid |
| PubChem CID | 87544745 |
| Molecular Formula | C15H14Cl2N2O4S |
| Molecular Weight | 389.26 g/mol |
| Exact Mass | 388.01 |
| IUPAC Name | (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid |
| SMILES | Cc1nn(C)c(Sc2cc(O[C@H](C)C(=O)O)c(Cl)cc2Cl)c1C=O |
| InChI | InChI=1S/C15H14Cl2N2O4S/c1-7-9(6-20)14(19(3)18-7)24-13-5-12(10(16)4-11(13)17)23-8(2)15(21)22/h4-6,8H,1-3H3,(H,21,22)/t8-/m1/s1 |
| InChIKey | AVHDACOVUCQFCN-MRVPVSSYSA-N |
| XLogP | 3.85 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid?
The IUPAC name of (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid (CID 87544745) is (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid.
What is the SMILES notation for (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid?
The canonical SMILES for (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid is Cc1nn(C)c(Sc2cc(O[C@H](C)C(=O)O)c(Cl)cc2Cl)c1C=O.
What is the InChIKey of (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid?
The InChIKey is AVHDACOVUCQFCN-MRVPVSSYSA-N. The full InChI is InChI=1S/C15H14Cl2N2O4S/c1-7-9(6-20)14(19(3)18-7)24-13-5-12(10(16)4-11(13)17)23-8(2)15(21)22/h4-6,8H,1-3H3,(H,21,22)/t8-/m1/s1.
What are the key properties of (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid?
(2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid has a molecular weight of 389.26 g/mol, XLogP of 3.85, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2,4-dichloro-5-(4-formyl-1,3-dimethylpyrazol-5-yl)sulfanylphenoxy]propanoic acid is sourced from PubChem (CID 87544745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).